C22H16BrN4O2S2+ — CID 136940402
7-benzoyl-6-(5-bromothiophen-2-yl)-3-methylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one (PubChem CID 136940402) has the molecular formula C22H16BrN4O2S2+ and a molecular weight of 512.43 g/mol. Its IUPAC name is 7-benzoyl-6-(5-bromothiophen-2-yl)-3-methylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one.
| Compound Name | 7-benzoyl-6-(5-bromothiophen-2-yl)-3-methylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one |
|---|---|
| PubChem CID | 136940402 |
| Molecular Formula | C22H16BrN4O2S2+ |
| Molecular Weight | 512.43 g/mol |
| Exact Mass | 510.99 |
| IUPAC Name | 7-benzoyl-6-(5-bromothiophen-2-yl)-3-methylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one |
| SMILES | CSc1n[n+]2c(c(=O)[nH]1)-c1ccccc1N(C(=O)c1ccccc1)C2c1ccc(Br)s1 |
| InChI | InChI=1S/C22H15BrN4O2S2/c1-30-22-24-19(28)18-14-9-5-6-10-15(14)26(21(29)13-7-3-2-4-8-13)20(27(18)25-22)16-11-12-17(23)31-16/h2-12,20H,1H3/p+1 |
| InChIKey | CRBBSSZZWLFLSA-UHFFFAOYSA-O |
| XLogP | 4.48 |
| TPSA | 69.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.43 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|