C22H15BrN4O2S2 — CID 117057630
7-benzoyl-6-(5-bromothiophen-2-yl)-3-methylsulfanyl-6H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-olate (PubChem CID 117057630) has the molecular formula C22H15BrN4O2S2 and a molecular weight of 511.43 g/mol. Its IUPAC name is 7-benzoyl-6-(5-bromothiophen-2-yl)-3-methylsulfanyl-6H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-olate.
| Compound Name | 7-benzoyl-6-(5-bromothiophen-2-yl)-3-methylsulfanyl-6H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-olate |
|---|---|
| PubChem CID | 117057630 |
| Molecular Formula | C22H15BrN4O2S2 |
| Molecular Weight | 511.43 g/mol |
| Exact Mass | 509.98 |
| IUPAC Name | 7-benzoyl-6-(5-bromothiophen-2-yl)-3-methylsulfanyl-6H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-olate |
| SMILES | CSc1nc([O-])c2[n+](n1)C(c1ccc(Br)s1)N(C(=O)c1ccccc1)c1ccccc1-2 |
| InChI | InChI=1S/C22H15BrN4O2S2/c1-30-22-24-19(28)18-14-9-5-6-10-15(14)26(21(29)13-7-3-2-4-8-13)20(27(18)25-22)16-11-12-17(23)31-16/h2-12,20H,1H3 |
| InChIKey | CRBBSSZZWLFLSA-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 73.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.43 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|