C27H33N4O5S+ — CID 136940083
7-acetyl-3-hexylsulfanyl-6-(2,3,4-trimethoxyphenyl)-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one (PubChem CID 136940083) has the molecular formula C27H33N4O5S+ and a molecular weight of 525.65 g/mol. Its IUPAC name is 7-acetyl-3-hexylsulfanyl-6-(2,3,4-trimethoxyphenyl)-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one.
| Compound Name | 7-acetyl-3-hexylsulfanyl-6-(2,3,4-trimethoxyphenyl)-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one |
|---|---|
| PubChem CID | 136940083 |
| Molecular Formula | C27H33N4O5S+ |
| Molecular Weight | 525.65 g/mol |
| Exact Mass | 525.22 |
| IUPAC Name | 7-acetyl-3-hexylsulfanyl-6-(2,3,4-trimethoxyphenyl)-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one |
| SMILES | CCCCCCSc1n[n+]2c(c(=O)[nH]1)-c1ccccc1N(C(C)=O)C2c1ccc(OC)c(OC)c1OC |
| InChI | InChI=1S/C27H32N4O5S/c1-6-7-8-11-16-37-27-28-25(33)22-18-12-9-10-13-20(18)30(17(2)32)26(31(22)29-27)19-14-15-21(34-3)24(36-5)23(19)35-4/h9-10,12-15,26H,6-8,11,16H2,1-5H3/p+1 |
| InChIKey | DDZMYYLEYBKAGW-UHFFFAOYSA-O |
| XLogP | 4.34 |
| TPSA | 97.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.65 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|