C24H26ClN4O4S+ — CID 136939560
7-acetyl-3-butylsulfanyl-6-(2-chloro-4,5-dimethoxyphenyl)-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one (PubChem CID 136939560) has the molecular formula C24H26ClN4O4S+ and a molecular weight of 502.02 g/mol. Its IUPAC name is 7-acetyl-3-butylsulfanyl-6-(2-chloro-4,5-dimethoxyphenyl)-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one.
| Compound Name | 7-acetyl-3-butylsulfanyl-6-(2-chloro-4,5-dimethoxyphenyl)-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one |
|---|---|
| PubChem CID | 136939560 |
| Molecular Formula | C24H26ClN4O4S+ |
| Molecular Weight | 502.02 g/mol |
| Exact Mass | 501.14 |
| IUPAC Name | 7-acetyl-3-butylsulfanyl-6-(2-chloro-4,5-dimethoxyphenyl)-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one |
| SMILES | CCCCSc1n[n+]2c(c(=O)[nH]1)-c1ccccc1N(C(C)=O)C2c1cc(OC)c(OC)cc1Cl |
| InChI | InChI=1S/C24H25ClN4O4S/c1-5-6-11-34-24-26-22(31)21-15-9-7-8-10-18(15)28(14(2)30)23(29(21)27-24)16-12-19(32-3)20(33-4)13-17(16)25/h7-10,12-13,23H,5-6,11H2,1-4H3/p+1 |
| InChIKey | MFXQMMCVQZLDJJ-UHFFFAOYSA-O |
| XLogP | 4.20 |
| TPSA | 88.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.02 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|