C24H24ClN4O4S+ — CID 136940099
[3-(7-acetyl-3-butylsulfanyl-1-oxo-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-6-yl)-2-chlorophenyl] acetate (PubChem CID 136940099) has the molecular formula C24H24ClN4O4S+ and a molecular weight of 500.00 g/mol. Its IUPAC name is [3-(7-acetyl-3-butylsulfanyl-1-oxo-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-6-yl)-2-chlorophenyl] acetate.
| Compound Name | [3-(7-acetyl-3-butylsulfanyl-1-oxo-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-6-yl)-2-chlorophenyl] acetate |
|---|---|
| PubChem CID | 136940099 |
| Molecular Formula | C24H24ClN4O4S+ |
| Molecular Weight | 500.00 g/mol |
| Exact Mass | 499.12 |
| IUPAC Name | [3-(7-acetyl-3-butylsulfanyl-1-oxo-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-6-yl)-2-chlorophenyl] acetate |
| SMILES | CCCCSc1n[n+]2c(c(=O)[nH]1)-c1ccccc1N(C(C)=O)C2c1cccc(OC(C)=O)c1Cl |
| InChI | InChI=1S/C24H23ClN4O4S/c1-4-5-13-34-24-26-22(32)21-16-9-6-7-11-18(16)28(14(2)30)23(29(21)27-24)17-10-8-12-19(20(17)25)33-15(3)31/h6-12,23H,4-5,13H2,1-3H3/p+1 |
| InChIKey | FTWHFSGWSRNOAI-UHFFFAOYSA-O |
| XLogP | 4.11 |
| TPSA | 96.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.00 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|