C21H18BrIN4O3S — CID 136940195
10-bromo-6-(3-iodo-4,5-dimethoxyphenyl)-3-prop-2-enylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one (PubChem CID 136940195) has the molecular formula C21H18BrIN4O3S and a molecular weight of 613.27 g/mol. Its IUPAC name is 10-bromo-6-(3-iodo-4,5-dimethoxyphenyl)-3-prop-2-enylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one.
| Compound Name | 10-bromo-6-(3-iodo-4,5-dimethoxyphenyl)-3-prop-2-enylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
|---|---|
| PubChem CID | 136940195 |
| Molecular Formula | C21H18BrIN4O3S |
| Molecular Weight | 613.27 g/mol |
| Exact Mass | 611.93 |
| IUPAC Name | 10-bromo-6-(3-iodo-4,5-dimethoxyphenyl)-3-prop-2-enylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
| SMILES | C=CCSC1=NN2C(=c3cc(Br)ccc3=NC2c2cc(I)c(OC)c(OC)c2)C(=O)N1 |
| InChI | InChI=1S/C21H18BrIN4O3S/c1-4-7-31-21-25-20(28)17-13-10-12(22)5-6-15(13)24-19(27(17)26-21)11-8-14(23)18(30-3)16(9-11)29-2/h4-6,8-10,19H,1,7H2,2-3H3,(H,25,26,28) |
| InChIKey | UNYOTLLBKLQEEZ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 75.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.27 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|