C18H21ClN4O2 — CID 136948058
N-(3-chloro-2-methylphenyl)-3-(2-methyl-6-oxo-1H-pyrimidin-4-yl)piperidine-1-carboxamide (PubChem CID 136948058) has the molecular formula C18H21ClN4O2 and a molecular weight of 360.85 g/mol. Its IUPAC name is N-(3-chloro-2-methylphenyl)-3-(2-methyl-6-oxo-1H-pyrimidin-4-yl)piperidine-1-carboxamide.
| Compound Name | N-(3-chloro-2-methylphenyl)-3-(2-methyl-6-oxo-1H-pyrimidin-4-yl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 136948058 |
| Molecular Formula | C18H21ClN4O2 |
| Molecular Weight | 360.85 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | N-(3-chloro-2-methylphenyl)-3-(2-methyl-6-oxo-1H-pyrimidin-4-yl)piperidine-1-carboxamide |
| SMILES | Cc1nc(C2CCCN(C(=O)Nc3cccc(Cl)c3C)C2)cc(=O)[nH]1 |
| InChI | InChI=1S/C18H21ClN4O2/c1-11-14(19)6-3-7-15(11)22-18(25)23-8-4-5-13(10-23)16-9-17(24)21-12(2)20-16/h3,6-7,9,13H,4-5,8,10H2,1-2H3,(H,22,25)(H,20,21,24) |
| InChIKey | BZKGTFKRSBLISF-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.85 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |