C31H23F3N6O4S — CID 136949554
1-[2-(1-oxidopyridin-1-ium-4-yl)-5-(trifluoromethyl)phenyl]-3-[6-[4-[2-(2-oxopyrrolidin-1-yl)-1,3-thiazol-5-yl]phenoxy]-3-pyridinyl]urea (PubChem CID 136949554) has the molecular formula C31H23F3N6O4S and a molecular weight of 632.62 g/mol. Its IUPAC name is 1-[2-(1-oxidopyridin-1-ium-4-yl)-5-(trifluoromethyl)phenyl]-3-[6-[4-[2-(2-oxopyrrolidin-1-yl)-1,3-thiazol-5-yl]phenoxy]-3-pyridinyl]urea.
| Compound Name | 1-[2-(1-oxidopyridin-1-ium-4-yl)-5-(trifluoromethyl)phenyl]-3-[6-[4-[2-(2-oxopyrrolidin-1-yl)-1,3-thiazol-5-yl]phenoxy]-3-pyridinyl]urea |
|---|---|
| PubChem CID | 136949554 |
| Molecular Formula | C31H23F3N6O4S |
| Molecular Weight | 632.62 g/mol |
| Exact Mass | 632.15 |
| IUPAC Name | 1-[2-(1-oxidopyridin-1-ium-4-yl)-5-(trifluoromethyl)phenyl]-3-[6-[4-[2-(2-oxopyrrolidin-1-yl)-1,3-thiazol-5-yl]phenoxy]-3-pyridinyl]urea |
| SMILES | O=C(Nc1ccc(Oc2ccc(-c3cnc(N4CCCC4=O)s3)cc2)nc1)Nc1cc(C(F)(F)F)ccc1-c1cc[n+]([O-])cc1 |
| InChI | InChI=1S/C31H23F3N6O4S/c32-31(33,34)21-5-9-24(19-11-14-39(43)15-12-19)25(16-21)38-29(42)37-22-6-10-27(35-17-22)44-23-7-3-20(4-8-23)26-18-36-30(45-26)40-13-1-2-28(40)41/h3-12,14-18H,1-2,13H2,(H2,37,38,42) |
| InChIKey | QJMDUSODSYGIIX-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 123.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.62 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|