C32H27F3N6O3S — CID 118680072
1-[2-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-5-(trifluoromethyl)-3-pyridinyl]-3-[6-[4-[2-(2-oxopyrrolidin-1-yl)-1,3-thiazol-5-yl]phenoxy]-3-pyridinyl]urea (PubChem CID 118680072) has the molecular formula C32H27F3N6O3S and a molecular weight of 632.67 g/mol. Its IUPAC name is 1-[2-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-5-(trifluoromethyl)-3-pyridinyl]-3-[6-[4-[2-(2-oxopyrrolidin-1-yl)-1,3-thiazol-5-yl]phenoxy]-3-pyridinyl]urea.
| Compound Name | 1-[2-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-5-(trifluoromethyl)-3-pyridinyl]-3-[6-[4-[2-(2-oxopyrrolidin-1-yl)-1,3-thiazol-5-yl]phenoxy]-3-pyridinyl]urea |
|---|---|
| PubChem CID | 118680072 |
| Molecular Formula | C32H27F3N6O3S |
| Molecular Weight | 632.67 g/mol |
| Exact Mass | 632.18 |
| IUPAC Name | 1-[2-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-5-(trifluoromethyl)-3-pyridinyl]-3-[6-[4-[2-(2-oxopyrrolidin-1-yl)-1,3-thiazol-5-yl]phenoxy]-3-pyridinyl]urea |
| SMILES | C=C/C=C\C(=C/C)c1ncc(C(F)(F)F)cc1NC(=O)Nc1ccc(Oc2ccc(-c3cnc(N4CCCC4=O)s3)cc2)nc1 |
| InChI | InChI=1S/C32H27F3N6O3S/c1-3-5-7-20(4-2)29-25(16-22(17-37-29)32(33,34)35)40-30(43)39-23-11-14-27(36-18-23)44-24-12-9-21(10-13-24)26-19-38-31(45-26)41-15-6-8-28(41)42/h3-5,7,9-14,16-19H,1,6,8,15H2,2H3,(H2,39,40,43)/b7-5-,20-4+ |
| InChIKey | HGSHSXCFLPOBEP-BRWNMRJLSA-N |
| XLogP | 8.33 |
| TPSA | 109.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.67 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|