C13H11ClN4OS — CID 136953924
5-[3-[(5-chlorothiophen-2-yl)methylamino]-1H-pyrazol-5-yl]-1H-pyridin-2-one (PubChem CID 136953924) has the molecular formula C13H11ClN4OS and a molecular weight of 306.78 g/mol. Its IUPAC name is 5-[3-[(5-chlorothiophen-2-yl)methylamino]-1H-pyrazol-5-yl]-1H-pyridin-2-one.
| Compound Name | 5-[3-[(5-chlorothiophen-2-yl)methylamino]-1H-pyrazol-5-yl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 136953924 |
| Molecular Formula | C13H11ClN4OS |
| Molecular Weight | 306.78 g/mol |
| Exact Mass | 306.03 |
| IUPAC Name | 5-[3-[(5-chlorothiophen-2-yl)methylamino]-1H-pyrazol-5-yl]-1H-pyridin-2-one |
| SMILES | O=c1ccc(-c2cc(NCc3ccc(Cl)s3)n[nH]2)c[nH]1 |
| InChI | InChI=1S/C13H11ClN4OS/c14-11-3-2-9(20-11)7-15-12-5-10(17-18-12)8-1-4-13(19)16-6-8/h1-6H,7H2,(H,16,19)(H2,15,17,18) |
| InChIKey | DFUKDYMHMYRVID-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 73.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.78 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |