C11H11Cl2N3 — CID 63047423
5-(3,4-dichlorophenyl)-N-ethyl-1H-pyrazol-3-amine (PubChem CID 63047423) has the molecular formula C11H11Cl2N3 and a molecular weight of 256.14 g/mol. Its IUPAC name is 5-(3,4-dichlorophenyl)-N-ethyl-1H-pyrazol-3-amine.
| Compound Name | 5-(3,4-dichlorophenyl)-N-ethyl-1H-pyrazol-3-amine |
|---|---|
| PubChem CID | 63047423 |
| Molecular Formula | C11H11Cl2N3 |
| Molecular Weight | 256.14 g/mol |
| Exact Mass | 255.03 |
| IUPAC Name | 5-(3,4-dichlorophenyl)-N-ethyl-1H-pyrazol-3-amine |
| SMILES | CCNc1cc(-c2ccc(Cl)c(Cl)c2)[nH]n1 |
| InChI | InChI=1S/C11H11Cl2N3/c1-2-14-11-6-10(15-16-11)7-3-4-8(12)9(13)5-7/h3-6H,2H2,1H3,(H2,14,15,16) |
| InChIKey | PFWDRKDDBWSNNM-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.14 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |