C9H13N3O3 — CID 136956203
methyl 3-[(2-methyl-6-oxo-1H-pyrimidin-4-yl)amino]propanoate (PubChem CID 136956203) has the molecular formula C9H13N3O3 and a molecular weight of 211.22 g/mol. Its IUPAC name is methyl 3-[(2-methyl-6-oxo-1H-pyrimidin-4-yl)amino]propanoate.
| Compound Name | methyl 3-[(2-methyl-6-oxo-1H-pyrimidin-4-yl)amino]propanoate |
|---|---|
| PubChem CID | 136956203 |
| Molecular Formula | C9H13N3O3 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | methyl 3-[(2-methyl-6-oxo-1H-pyrimidin-4-yl)amino]propanoate |
| SMILES | COC(=O)CCNc1cc(=O)[nH]c(C)n1 |
| InChI | InChI=1S/C9H13N3O3/c1-6-11-7(5-8(13)12-6)10-4-3-9(14)15-2/h5H,3-4H2,1-2H3,(H2,10,11,12,13) |
| InChIKey | AYEIRRNSCBHSAT-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |