C13H20IN3O2 — CID 136957035
4-[(2,2-diethyloxan-4-yl)amino]-5-iodo-1H-pyrimidin-6-one (PubChem CID 136957035) has the molecular formula C13H20IN3O2 and a molecular weight of 377.23 g/mol. Its IUPAC name is 4-[(2,2-diethyloxan-4-yl)amino]-5-iodo-1H-pyrimidin-6-one.
| Compound Name | 4-[(2,2-diethyloxan-4-yl)amino]-5-iodo-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136957035 |
| Molecular Formula | C13H20IN3O2 |
| Molecular Weight | 377.23 g/mol |
| Exact Mass | 377.06 |
| IUPAC Name | 4-[(2,2-diethyloxan-4-yl)amino]-5-iodo-1H-pyrimidin-6-one |
| SMILES | CCC1(CC)CC(Nc2nc[nH]c(=O)c2I)CCO1 |
| InChI | InChI=1S/C13H20IN3O2/c1-3-13(4-2)7-9(5-6-19-13)17-11-10(14)12(18)16-8-15-11/h8-9H,3-7H2,1-2H3,(H2,15,16,17,18) |
| InChIKey | DJIDFLMUNKKCEF-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.23 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|