C8H12IN3O2 — CID 136957726
4-[2-hydroxypropyl(methyl)amino]-5-iodo-1H-pyrimidin-6-one (PubChem CID 136957726) has the molecular formula C8H12IN3O2 and a molecular weight of 309.11 g/mol. Its IUPAC name is 4-[2-hydroxypropyl(methyl)amino]-5-iodo-1H-pyrimidin-6-one.
| Compound Name | 4-[2-hydroxypropyl(methyl)amino]-5-iodo-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136957726 |
| Molecular Formula | C8H12IN3O2 |
| Molecular Weight | 309.11 g/mol |
| Exact Mass | 309.00 |
| IUPAC Name | 4-[2-hydroxypropyl(methyl)amino]-5-iodo-1H-pyrimidin-6-one |
| SMILES | CC(O)CN(C)c1nc[nH]c(=O)c1I |
| InChI | InChI=1S/C8H12IN3O2/c1-5(13)3-12(2)7-6(9)8(14)11-4-10-7/h4-5,13H,3H2,1-2H3,(H,10,11,14) |
| InChIKey | IBPAEAFEJTVCNH-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 69.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.11 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|