C11H17N5O3 — CID 136958456
3-[4-(5-amino-6-oxo-1H-pyrimidin-4-yl)piperazin-1-yl]propanoic acid (PubChem CID 136958456) has the molecular formula C11H17N5O3 and a molecular weight of 267.29 g/mol. Its IUPAC name is 3-[4-(5-amino-6-oxo-1H-pyrimidin-4-yl)piperazin-1-yl]propanoic acid.
| Compound Name | 3-[4-(5-amino-6-oxo-1H-pyrimidin-4-yl)piperazin-1-yl]propanoic acid |
|---|---|
| PubChem CID | 136958456 |
| Molecular Formula | C11H17N5O3 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | 3-[4-(5-amino-6-oxo-1H-pyrimidin-4-yl)piperazin-1-yl]propanoic acid |
| SMILES | Nc1c(N2CCN(CCC(=O)O)CC2)nc[nH]c1=O |
| InChI | InChI=1S/C11H17N5O3/c12-9-10(13-7-14-11(9)19)16-5-3-15(4-6-16)2-1-8(17)18/h7H,1-6,12H2,(H,17,18)(H,13,14,19) |
| InChIKey | QCVDHFWEPFRNQW-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 115.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |