C9H14N4O3 — CID 136958655
3-[(5-amino-6-oxo-1H-pyrimidin-4-yl)-methylamino]-2-methylpropanoic acid (PubChem CID 136958655) has the molecular formula C9H14N4O3 and a molecular weight of 226.24 g/mol. Its IUPAC name is 3-[(5-amino-6-oxo-1H-pyrimidin-4-yl)-methylamino]-2-methylpropanoic acid.
| Compound Name | 3-[(5-amino-6-oxo-1H-pyrimidin-4-yl)-methylamino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 136958655 |
| Molecular Formula | C9H14N4O3 |
| Molecular Weight | 226.24 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 3-[(5-amino-6-oxo-1H-pyrimidin-4-yl)-methylamino]-2-methylpropanoic acid |
| SMILES | CC(CN(C)c1nc[nH]c(=O)c1N)C(=O)O |
| InChI | InChI=1S/C9H14N4O3/c1-5(9(15)16)3-13(2)7-6(10)8(14)12-4-11-7/h4-5H,3,10H2,1-2H3,(H,15,16)(H,11,12,14) |
| InChIKey | OFXXZQHUEACORN-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 112.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.24 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |