C15H15N5O4 — CID 136961366
N-[8-(2,3-dimethoxyphenyl)-6-oxo-1,7-dihydropurin-2-yl]acetamide (PubChem CID 136961366) has the molecular formula C15H15N5O4 and a molecular weight of 329.32 g/mol. Its IUPAC name is N-[8-(2,3-dimethoxyphenyl)-6-oxo-1,7-dihydropurin-2-yl]acetamide.
| Compound Name | N-[8-(2,3-dimethoxyphenyl)-6-oxo-1,7-dihydropurin-2-yl]acetamide |
|---|---|
| PubChem CID | 136961366 |
| Molecular Formula | C15H15N5O4 |
| Molecular Weight | 329.32 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | N-[8-(2,3-dimethoxyphenyl)-6-oxo-1,7-dihydropurin-2-yl]acetamide |
| SMILES | COc1cccc(-c2nc3nc(NC(C)=O)[nH]c(=O)c3[nH]2)c1OC |
| InChI | InChI=1S/C15H15N5O4/c1-7(21)16-15-19-13-10(14(22)20-15)17-12(18-13)8-5-4-6-9(23-2)11(8)24-3/h4-6H,1-3H3,(H3,16,17,18,19,20,21,22) |
| InChIKey | AUKQIOXDNIJPDU-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 121.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.32 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |