C24H18ClF7N4O3 — CID 136964914
N-[[4-chloro-3-[4-[4-(cyclopropylmethoxy)phenyl]-6-oxo-1H-1,3,5-triazin-2-yl]phenyl]methyl]-2,3,3,3-tetrafluoro-2-(trifluoromethyl)propanamide (PubChem CID 136964914) has the molecular formula C24H18ClF7N4O3 and a molecular weight of 578.87 g/mol. Its IUPAC name is N-[[4-chloro-3-[4-[4-(cyclopropylmethoxy)phenyl]-6-oxo-1H-1,3,5-triazin-2-yl]phenyl]methyl]-2,3,3,3-tetrafluoro-2-(trifluoromethyl)propanamide.
| Compound Name | N-[[4-chloro-3-[4-[4-(cyclopropylmethoxy)phenyl]-6-oxo-1H-1,3,5-triazin-2-yl]phenyl]methyl]-2,3,3,3-tetrafluoro-2-(trifluoromethyl)propanamide |
|---|---|
| PubChem CID | 136964914 |
| Molecular Formula | C24H18ClF7N4O3 |
| Molecular Weight | 578.87 g/mol |
| Exact Mass | 578.10 |
| IUPAC Name | N-[[4-chloro-3-[4-[4-(cyclopropylmethoxy)phenyl]-6-oxo-1H-1,3,5-triazin-2-yl]phenyl]methyl]-2,3,3,3-tetrafluoro-2-(trifluoromethyl)propanamide |
| SMILES | O=C(NCc1ccc(Cl)c(-c2nc(-c3ccc(OCC4CC4)cc3)nc(=O)[nH]2)c1)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C24H18ClF7N4O3/c25-17-8-3-13(10-33-20(37)22(26,23(27,28)29)24(30,31)32)9-16(17)19-34-18(35-21(38)36-19)14-4-6-15(7-5-14)39-11-12-1-2-12/h3-9,12H,1-2,10-11H2,(H,33,37)(H,34,35,36,38) |
| InChIKey | HXOFSJMTZUJVQJ-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.87 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |