C25H26ClF3N4O3 — CID 137159727
N-[[4-chloro-3-[4-[3-(2-methoxypropan-2-yl)phenyl]-6-oxo-1H-1,3,5-triazin-2-yl]phenyl]methyl]-3,3,3-trifluoro-2,2-dimethylpropanamide (PubChem CID 137159727) has the molecular formula C25H26ClF3N4O3 and a molecular weight of 522.96 g/mol. Its IUPAC name is N-[[4-chloro-3-[4-[3-(2-methoxypropan-2-yl)phenyl]-6-oxo-1H-1,3,5-triazin-2-yl]phenyl]methyl]-3,3,3-trifluoro-2,2-dimethylpropanamide.
| Compound Name | N-[[4-chloro-3-[4-[3-(2-methoxypropan-2-yl)phenyl]-6-oxo-1H-1,3,5-triazin-2-yl]phenyl]methyl]-3,3,3-trifluoro-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 137159727 |
| Molecular Formula | C25H26ClF3N4O3 |
| Molecular Weight | 522.96 g/mol |
| Exact Mass | 522.16 |
| IUPAC Name | N-[[4-chloro-3-[4-[3-(2-methoxypropan-2-yl)phenyl]-6-oxo-1H-1,3,5-triazin-2-yl]phenyl]methyl]-3,3,3-trifluoro-2,2-dimethylpropanamide |
| SMILES | COC(C)(C)c1cccc(-c2nc(-c3cc(CNC(=O)C(C)(C)C(F)(F)F)ccc3Cl)[nH]c(=O)n2)c1 |
| InChI | InChI=1S/C25H26ClF3N4O3/c1-23(2,25(27,28)29)21(34)30-13-14-9-10-18(26)17(11-14)20-31-19(32-22(35)33-20)15-7-6-8-16(12-15)24(3,4)36-5/h6-12H,13H2,1-5H3,(H,30,34)(H,31,32,33,35) |
| InChIKey | CNSQEKJFXXSWJG-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.96 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |