C26H29ClF3N5O3 — CID 137159643
N-[[4-chloro-3-[4-(6-hexoxy-3-pyridinyl)-6-oxo-1H-1,3,5-triazin-2-yl]phenyl]methyl]-3,3,3-trifluoro-2,2-dimethylpropanamide (PubChem CID 137159643) has the molecular formula C26H29ClF3N5O3 and a molecular weight of 552.00 g/mol. Its IUPAC name is N-[[4-chloro-3-[4-(6-hexoxy-3-pyridinyl)-6-oxo-1H-1,3,5-triazin-2-yl]phenyl]methyl]-3,3,3-trifluoro-2,2-dimethylpropanamide.
| Compound Name | N-[[4-chloro-3-[4-(6-hexoxy-3-pyridinyl)-6-oxo-1H-1,3,5-triazin-2-yl]phenyl]methyl]-3,3,3-trifluoro-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 137159643 |
| Molecular Formula | C26H29ClF3N5O3 |
| Molecular Weight | 552.00 g/mol |
| Exact Mass | 551.19 |
| IUPAC Name | N-[[4-chloro-3-[4-(6-hexoxy-3-pyridinyl)-6-oxo-1H-1,3,5-triazin-2-yl]phenyl]methyl]-3,3,3-trifluoro-2,2-dimethylpropanamide |
| SMILES | CCCCCCOc1ccc(-c2nc(-c3cc(CNC(=O)C(C)(C)C(F)(F)F)ccc3Cl)[nH]c(=O)n2)cn1 |
| InChI | InChI=1S/C26H29ClF3N5O3/c1-4-5-6-7-12-38-20-11-9-17(15-31-20)21-33-22(35-24(37)34-21)18-13-16(8-10-19(18)27)14-32-23(36)25(2,3)26(28,29)30/h8-11,13,15H,4-7,12,14H2,1-3H3,(H,32,36)(H,33,34,35,37) |
| InChIKey | DQLLBATVMRZNLE-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 109.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.00 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|