C29H34ClF3N4O2 — CID 137159699
N-[[4-chloro-3-[4-(3,5-ditert-butylphenyl)-6-oxo-1H-1,3,5-triazin-2-yl]phenyl]methyl]-3,3,3-trifluoro-2,2-dimethylpropanamide (PubChem CID 137159699) has the molecular formula C29H34ClF3N4O2 and a molecular weight of 563.06 g/mol. Its IUPAC name is N-[[4-chloro-3-[4-(3,5-ditert-butylphenyl)-6-oxo-1H-1,3,5-triazin-2-yl]phenyl]methyl]-3,3,3-trifluoro-2,2-dimethylpropanamide.
| Compound Name | N-[[4-chloro-3-[4-(3,5-ditert-butylphenyl)-6-oxo-1H-1,3,5-triazin-2-yl]phenyl]methyl]-3,3,3-trifluoro-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 137159699 |
| Molecular Formula | C29H34ClF3N4O2 |
| Molecular Weight | 563.06 g/mol |
| Exact Mass | 562.23 |
| IUPAC Name | N-[[4-chloro-3-[4-(3,5-ditert-butylphenyl)-6-oxo-1H-1,3,5-triazin-2-yl]phenyl]methyl]-3,3,3-trifluoro-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)c1cc(-c2nc(-c3cc(CNC(=O)C(C)(C)C(F)(F)F)ccc3Cl)[nH]c(=O)n2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C29H34ClF3N4O2/c1-26(2,3)18-12-17(13-19(14-18)27(4,5)6)22-35-23(37-25(39)36-22)20-11-16(9-10-21(20)30)15-34-24(38)28(7,8)29(31,32)33/h9-14H,15H2,1-8H3,(H,34,38)(H,35,36,37,39) |
| InChIKey | FKOLYUKPQCXNKU-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.06 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |