C25H27ClF3N5O4 — CID 137159664
N-[[4-chloro-3-[4-[6-(4-methoxybutoxy)-3-pyridinyl]-6-oxo-1H-1,3,5-triazin-2-yl]phenyl]methyl]-3,3,3-trifluoro-2,2-dimethylpropanamide (PubChem CID 137159664) has the molecular formula C25H27ClF3N5O4 and a molecular weight of 553.97 g/mol. Its IUPAC name is N-[[4-chloro-3-[4-[6-(4-methoxybutoxy)-3-pyridinyl]-6-oxo-1H-1,3,5-triazin-2-yl]phenyl]methyl]-3,3,3-trifluoro-2,2-dimethylpropanamide.
| Compound Name | N-[[4-chloro-3-[4-[6-(4-methoxybutoxy)-3-pyridinyl]-6-oxo-1H-1,3,5-triazin-2-yl]phenyl]methyl]-3,3,3-trifluoro-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 137159664 |
| Molecular Formula | C25H27ClF3N5O4 |
| Molecular Weight | 553.97 g/mol |
| Exact Mass | 553.17 |
| IUPAC Name | N-[[4-chloro-3-[4-[6-(4-methoxybutoxy)-3-pyridinyl]-6-oxo-1H-1,3,5-triazin-2-yl]phenyl]methyl]-3,3,3-trifluoro-2,2-dimethylpropanamide |
| SMILES | COCCCCOc1ccc(-c2nc(-c3cc(CNC(=O)C(C)(C)C(F)(F)F)ccc3Cl)[nH]c(=O)n2)cn1 |
| InChI | InChI=1S/C25H27ClF3N5O4/c1-24(2,25(27,28)29)22(35)31-13-15-6-8-18(26)17(12-15)21-32-20(33-23(36)34-21)16-7-9-19(30-14-16)38-11-5-4-10-37-3/h6-9,12,14H,4-5,10-11,13H2,1-3H3,(H,31,35)(H,32,33,34,36) |
| InChIKey | BIXYJESGTHQWQG-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 119.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.97 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|