C13H9F3N2O — CID 136967038
5-(2-methyl-1H-indol-3-yl)-3-(trifluoromethyl)-1,2-oxazole (PubChem CID 136967038) has the molecular formula C13H9F3N2O and a molecular weight of 266.22 g/mol. Its IUPAC name is 5-(2-methyl-1H-indol-3-yl)-3-(trifluoromethyl)-1,2-oxazole.
| Compound Name | 5-(2-methyl-1H-indol-3-yl)-3-(trifluoromethyl)-1,2-oxazole |
|---|---|
| PubChem CID | 136967038 |
| Molecular Formula | C13H9F3N2O |
| Molecular Weight | 266.22 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 5-(2-methyl-1H-indol-3-yl)-3-(trifluoromethyl)-1,2-oxazole |
| SMILES | Cc1[nH]c2ccccc2c1-c1cc(C(F)(F)F)no1 |
| InChI | InChI=1S/C13H9F3N2O/c1-7-12(8-4-2-3-5-9(8)17-7)10-6-11(18-19-10)13(14,15)16/h2-6,17H,1H3 |
| InChIKey | LJIRLUVLTASATG-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.22 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |