C25H19F9N4O3 — CID 136970075
(2S)-4-[4-(difluoromethyl)phenyl]-2-[2-fluoro-4-(4,4,4-trifluorobutoxy)phenyl]-5-(5-oxo-4H-1,2,4-triazol-1-yl)-2-(trifluoromethyl)-1,3-dihydropyridin-6-one (PubChem CID 136970075) has the molecular formula C25H19F9N4O3 and a molecular weight of 594.43 g/mol. Its IUPAC name is (2S)-4-[4-(difluoromethyl)phenyl]-2-[2-fluoro-4-(4,4,4-trifluorobutoxy)phenyl]-5-(5-oxo-4H-1,2,4-triazol-1-yl)-2-(trifluoromethyl)-1,3-dihydropyridin-6-one.
| Compound Name | (2S)-4-[4-(difluoromethyl)phenyl]-2-[2-fluoro-4-(4,4,4-trifluorobutoxy)phenyl]-5-(5-oxo-4H-1,2,4-triazol-1-yl)-2-(trifluoromethyl)-1,3-dihydropyridin-6-one |
|---|---|
| PubChem CID | 136970075 |
| Molecular Formula | C25H19F9N4O3 |
| Molecular Weight | 594.43 g/mol |
| Exact Mass | 594.13 |
| IUPAC Name | (2S)-4-[4-(difluoromethyl)phenyl]-2-[2-fluoro-4-(4,4,4-trifluorobutoxy)phenyl]-5-(5-oxo-4H-1,2,4-triazol-1-yl)-2-(trifluoromethyl)-1,3-dihydropyridin-6-one |
| SMILES | O=C1N[C@@](c2ccc(OCCCC(F)(F)F)cc2F)(C(F)(F)F)CC(c2ccc(C(F)F)cc2)=C1n1nc[nH]c1=O |
| InChI | InChI=1S/C25H19F9N4O3/c26-18-10-15(41-9-1-8-24(29,30)31)6-7-17(18)23(25(32,33)34)11-16(13-2-4-14(5-3-13)20(27)28)19(21(39)37-23)38-22(40)35-12-36-38/h2-7,10,12,20H,1,8-9,11H2,(H,37,39)(H,35,36,40)/t23-/m0/s1 |
| InChIKey | FIYBBGGASQOKNZ-QHCPKHFHSA-N |
| XLogP | 5.72 |
| TPSA | 89.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.43 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|