C25H34N2O6 — CID 136970082
5-(2,4-dihydroxy-5-propan-2-ylphenyl)-4-[(4-pentylcyclohexanecarbonyl)amino]-1,2-oxazole-3-carboxylic acid (PubChem CID 136970082) has the molecular formula C25H34N2O6 and a molecular weight of 458.56 g/mol. Its IUPAC name is 5-(2,4-dihydroxy-5-propan-2-ylphenyl)-4-[(4-pentylcyclohexanecarbonyl)amino]-1,2-oxazole-3-carboxylic acid.
| Compound Name | 5-(2,4-dihydroxy-5-propan-2-ylphenyl)-4-[(4-pentylcyclohexanecarbonyl)amino]-1,2-oxazole-3-carboxylic acid |
|---|---|
| PubChem CID | 136970082 |
| Molecular Formula | C25H34N2O6 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.24 |
| IUPAC Name | 5-(2,4-dihydroxy-5-propan-2-ylphenyl)-4-[(4-pentylcyclohexanecarbonyl)amino]-1,2-oxazole-3-carboxylic acid |
| SMILES | CCCCCC1CCC(C(=O)Nc2c(C(=O)O)noc2-c2cc(C(C)C)c(O)cc2O)CC1 |
| InChI | InChI=1S/C25H34N2O6/c1-4-5-6-7-15-8-10-16(11-9-15)24(30)26-21-22(25(31)32)27-33-23(21)18-12-17(14(2)3)19(28)13-20(18)29/h12-16,28-29H,4-11H2,1-3H3,(H,26,30)(H,31,32) |
| InChIKey | SKRAULPOPPDKKX-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 132.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|