C9H12IN3O3S — CID 136970865
4-[(1,1-dioxothiolan-3-yl)-methylamino]-5-iodo-1H-pyrimidin-6-one (PubChem CID 136970865) has the molecular formula C9H12IN3O3S and a molecular weight of 369.18 g/mol. Its IUPAC name is 4-[(1,1-dioxothiolan-3-yl)-methylamino]-5-iodo-1H-pyrimidin-6-one.
| Compound Name | 4-[(1,1-dioxothiolan-3-yl)-methylamino]-5-iodo-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136970865 |
| Molecular Formula | C9H12IN3O3S |
| Molecular Weight | 369.18 g/mol |
| Exact Mass | 368.96 |
| IUPAC Name | 4-[(1,1-dioxothiolan-3-yl)-methylamino]-5-iodo-1H-pyrimidin-6-one |
| SMILES | CN(c1nc[nH]c(=O)c1I)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C9H12IN3O3S/c1-13(6-2-3-17(15,16)4-6)8-7(10)9(14)12-5-11-8/h5-6H,2-4H2,1H3,(H,11,12,14) |
| InChIKey | YFEIENFBAVEMHZ-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 83.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.18 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|