C10H5F3IN3O — CID 136971247
5-iodo-4-(3,4,5-trifluoroanilino)-1H-pyrimidin-6-one (PubChem CID 136971247) has the molecular formula C10H5F3IN3O and a molecular weight of 367.07 g/mol. Its IUPAC name is 5-iodo-4-(3,4,5-trifluoroanilino)-1H-pyrimidin-6-one.
| Compound Name | 5-iodo-4-(3,4,5-trifluoroanilino)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136971247 |
| Molecular Formula | C10H5F3IN3O |
| Molecular Weight | 367.07 g/mol |
| Exact Mass | 366.94 |
| IUPAC Name | 5-iodo-4-(3,4,5-trifluoroanilino)-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]cnc(Nc2cc(F)c(F)c(F)c2)c1I |
| InChI | InChI=1S/C10H5F3IN3O/c11-5-1-4(2-6(12)7(5)13)17-9-8(14)10(18)16-3-15-9/h1-3H,(H2,15,16,17,18) |
| InChIKey | FRWFZBFDVGPCPB-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.07 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|