C9H10IN5O — CID 136956113
4-[(1-ethylpyrazol-4-yl)amino]-5-iodo-1H-pyrimidin-6-one (PubChem CID 136956113) has the molecular formula C9H10IN5O and a molecular weight of 331.12 g/mol. Its IUPAC name is 4-[(1-ethylpyrazol-4-yl)amino]-5-iodo-1H-pyrimidin-6-one.
| Compound Name | 4-[(1-ethylpyrazol-4-yl)amino]-5-iodo-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136956113 |
| Molecular Formula | C9H10IN5O |
| Molecular Weight | 331.12 g/mol |
| Exact Mass | 330.99 |
| IUPAC Name | 4-[(1-ethylpyrazol-4-yl)amino]-5-iodo-1H-pyrimidin-6-one |
| SMILES | CCn1cc(Nc2nc[nH]c(=O)c2I)cn1 |
| InChI | InChI=1S/C9H10IN5O/c1-2-15-4-6(3-13-15)14-8-7(10)9(16)12-5-11-8/h3-5H,2H2,1H3,(H2,11,12,14,16) |
| InChIKey | LXRDSUCRCNUBOV-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.12 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|