C10H10F2N4 — CID 112675617
N-(1-ethylpyrazol-4-yl)-3,5-difluoropyridin-2-amine (PubChem CID 112675617) has the molecular formula C10H10F2N4 and a molecular weight of 224.21 g/mol. Its IUPAC name is N-(1-ethylpyrazol-4-yl)-3,5-difluoropyridin-2-amine.
| Compound Name | N-(1-ethylpyrazol-4-yl)-3,5-difluoropyridin-2-amine |
|---|---|
| PubChem CID | 112675617 |
| Molecular Formula | C10H10F2N4 |
| Molecular Weight | 224.21 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | N-(1-ethylpyrazol-4-yl)-3,5-difluoropyridin-2-amine |
| SMILES | CCn1cc(Nc2ncc(F)cc2F)cn1 |
| InChI | InChI=1S/C10H10F2N4/c1-2-16-6-8(5-14-16)15-10-9(12)3-7(11)4-13-10/h3-6H,2H2,1H3,(H,13,15) |
| InChIKey | KYABLHCXOIBOHT-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.21 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |