C9H12ClN3O3S2 — CID 136971397
5-chloro-4-(3-methylsulfonylthiomorpholin-4-yl)-1H-pyrimidin-6-one (PubChem CID 136971397) has the molecular formula C9H12ClN3O3S2 and a molecular weight of 309.80 g/mol. Its IUPAC name is 5-chloro-4-(3-methylsulfonylthiomorpholin-4-yl)-1H-pyrimidin-6-one.
| Compound Name | 5-chloro-4-(3-methylsulfonylthiomorpholin-4-yl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136971397 |
| Molecular Formula | C9H12ClN3O3S2 |
| Molecular Weight | 309.80 g/mol |
| Exact Mass | 309.00 |
| IUPAC Name | 5-chloro-4-(3-methylsulfonylthiomorpholin-4-yl)-1H-pyrimidin-6-one |
| SMILES | CS(=O)(=O)C1CSCCN1c1nc[nH]c(=O)c1Cl |
| InChI | InChI=1S/C9H12ClN3O3S2/c1-18(15,16)6-4-17-3-2-13(6)8-7(10)9(14)12-5-11-8/h5-6H,2-4H2,1H3,(H,11,12,14) |
| InChIKey | ULHKDSGYVATLJA-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 83.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.80 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |