C10H14ClN3OS — CID 136971627
5-chloro-4-(2,2-dimethylthiomorpholin-4-yl)-1H-pyrimidin-6-one (PubChem CID 136971627) has the molecular formula C10H14ClN3OS and a molecular weight of 259.76 g/mol. Its IUPAC name is 5-chloro-4-(2,2-dimethylthiomorpholin-4-yl)-1H-pyrimidin-6-one.
| Compound Name | 5-chloro-4-(2,2-dimethylthiomorpholin-4-yl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136971627 |
| Molecular Formula | C10H14ClN3OS |
| Molecular Weight | 259.76 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | 5-chloro-4-(2,2-dimethylthiomorpholin-4-yl)-1H-pyrimidin-6-one |
| SMILES | CC1(C)CN(c2nc[nH]c(=O)c2Cl)CCS1 |
| InChI | InChI=1S/C10H14ClN3OS/c1-10(2)5-14(3-4-16-10)8-7(11)9(15)13-6-12-8/h6H,3-5H2,1-2H3,(H,12,13,15) |
| InChIKey | LOYAXXWIPKLQNC-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.76 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |