C12H11BrIN3O — CID 136974365
4-[1-(3-bromophenyl)ethylamino]-5-iodo-1H-pyrimidin-6-one (PubChem CID 136974365) has the molecular formula C12H11BrIN3O and a molecular weight of 420.05 g/mol. Its IUPAC name is 4-[1-(3-bromophenyl)ethylamino]-5-iodo-1H-pyrimidin-6-one.
| Compound Name | 4-[1-(3-bromophenyl)ethylamino]-5-iodo-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136974365 |
| Molecular Formula | C12H11BrIN3O |
| Molecular Weight | 420.05 g/mol |
| Exact Mass | 418.91 |
| IUPAC Name | 4-[1-(3-bromophenyl)ethylamino]-5-iodo-1H-pyrimidin-6-one |
| SMILES | CC(Nc1nc[nH]c(=O)c1I)c1cccc(Br)c1 |
| InChI | InChI=1S/C12H11BrIN3O/c1-7(8-3-2-4-9(13)5-8)17-11-10(14)12(18)16-6-15-11/h2-7H,1H3,(H2,15,16,17,18) |
| InChIKey | GIJXEPPHBLBVBB-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.05 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|