C9H11ClN4O2 — CID 136975710
5-chloro-4-[(6-oxopiperidin-3-yl)amino]-1H-pyrimidin-6-one (PubChem CID 136975710) has the molecular formula C9H11ClN4O2 and a molecular weight of 242.67 g/mol. Its IUPAC name is 5-chloro-4-[(6-oxopiperidin-3-yl)amino]-1H-pyrimidin-6-one.
| Compound Name | 5-chloro-4-[(6-oxopiperidin-3-yl)amino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136975710 |
| Molecular Formula | C9H11ClN4O2 |
| Molecular Weight | 242.67 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | 5-chloro-4-[(6-oxopiperidin-3-yl)amino]-1H-pyrimidin-6-one |
| SMILES | O=C1CCC(Nc2nc[nH]c(=O)c2Cl)CN1 |
| InChI | InChI=1S/C9H11ClN4O2/c10-7-8(12-4-13-9(7)16)14-5-1-2-6(15)11-3-5/h4-5H,1-3H2,(H,11,15)(H2,12,13,14,16) |
| InChIKey | JURVWXWXODXYAO-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.67 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |