C10H10BrN3OS — CID 136976397
5-bromo-4-[(4-methylthiophen-3-yl)methylamino]-1H-pyrimidin-6-one (PubChem CID 136976397) has the molecular formula C10H10BrN3OS and a molecular weight of 300.18 g/mol. Its IUPAC name is 5-bromo-4-[(4-methylthiophen-3-yl)methylamino]-1H-pyrimidin-6-one.
| Compound Name | 5-bromo-4-[(4-methylthiophen-3-yl)methylamino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136976397 |
| Molecular Formula | C10H10BrN3OS |
| Molecular Weight | 300.18 g/mol |
| Exact Mass | 298.97 |
| IUPAC Name | 5-bromo-4-[(4-methylthiophen-3-yl)methylamino]-1H-pyrimidin-6-one |
| SMILES | Cc1cscc1CNc1nc[nH]c(=O)c1Br |
| InChI | InChI=1S/C10H10BrN3OS/c1-6-3-16-4-7(6)2-12-9-8(11)10(15)14-5-13-9/h3-5H,2H2,1H3,(H2,12,13,14,15) |
| InChIKey | MWVJOPUUYVIHCO-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.18 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |