C10H13BrN4O — CID 137011139
5-bromo-4-(1,2,3,6-tetrahydropyridin-4-ylmethylamino)-1H-pyrimidin-6-one (PubChem CID 137011139) has the molecular formula C10H13BrN4O and a molecular weight of 285.14 g/mol. Its IUPAC name is 5-bromo-4-(1,2,3,6-tetrahydropyridin-4-ylmethylamino)-1H-pyrimidin-6-one.
| Compound Name | 5-bromo-4-(1,2,3,6-tetrahydropyridin-4-ylmethylamino)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 137011139 |
| Molecular Formula | C10H13BrN4O |
| Molecular Weight | 285.14 g/mol |
| Exact Mass | 284.03 |
| IUPAC Name | 5-bromo-4-(1,2,3,6-tetrahydropyridin-4-ylmethylamino)-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]cnc(NCC2=CCNCC2)c1Br |
| InChI | InChI=1S/C10H13BrN4O/c11-8-9(14-6-15-10(8)16)13-5-7-1-3-12-4-2-7/h1,6,12H,2-5H2,(H2,13,14,15,16) |
| InChIKey | QCNOTZCHIJENRO-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.14 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|