C10H14N4 — CID 114694662
N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)pyrimidin-2-amine (PubChem CID 114694662) has the molecular formula C10H14N4 and a molecular weight of 190.25 g/mol. Its IUPAC name is N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)pyrimidin-2-amine.
| Compound Name | N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 114694662 |
| Molecular Formula | C10H14N4 |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)pyrimidin-2-amine |
| SMILES | C1=C(CNc2ncccn2)CCNC1 |
| InChI | InChI=1S/C10H14N4/c1-4-12-10(13-5-1)14-8-9-2-6-11-7-3-9/h1-2,4-5,11H,3,6-8H2,(H,12,13,14) |
| InChIKey | WEGLUDMMTMKODX-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|