C11H13ClFN3 — CID 114694684
5-chloro-3-fluoro-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)pyridin-2-amine (PubChem CID 114694684) has the molecular formula C11H13ClFN3 and a molecular weight of 241.70 g/mol. Its IUPAC name is 5-chloro-3-fluoro-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)pyridin-2-amine.
| Compound Name | 5-chloro-3-fluoro-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 114694684 |
| Molecular Formula | C11H13ClFN3 |
| Molecular Weight | 241.70 g/mol |
| Exact Mass | 241.08 |
| IUPAC Name | 5-chloro-3-fluoro-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)pyridin-2-amine |
| SMILES | Fc1cc(Cl)cnc1NCC1=CCNCC1 |
| InChI | InChI=1S/C11H13ClFN3/c12-9-5-10(13)11(16-7-9)15-6-8-1-3-14-4-2-8/h1,5,7,14H,2-4,6H2,(H,15,16) |
| InChIKey | ZXRNNQAZTCAMPV-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.70 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|