C15H17N3 — CID 114694669
N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)quinolin-4-amine (PubChem CID 114694669) has the molecular formula C15H17N3 and a molecular weight of 239.32 g/mol. Its IUPAC name is N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)quinolin-4-amine.
| Compound Name | N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)quinolin-4-amine |
|---|---|
| PubChem CID | 114694669 |
| Molecular Formula | C15H17N3 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)quinolin-4-amine |
| SMILES | C1=C(CNc2ccnc3ccccc23)CCNC1 |
| InChI | InChI=1S/C15H17N3/c1-2-4-14-13(3-1)15(7-10-17-14)18-11-12-5-8-16-9-6-12/h1-5,7,10,16H,6,8-9,11H2,(H,17,18) |
| InChIKey | HNSINLKABABCOG-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|