C16H19N3 — CID 114694487
2-methyl-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)quinolin-4-amine (PubChem CID 114694487) has the molecular formula C16H19N3 and a molecular weight of 253.35 g/mol. Its IUPAC name is 2-methyl-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)quinolin-4-amine.
| Compound Name | 2-methyl-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)quinolin-4-amine |
|---|---|
| PubChem CID | 114694487 |
| Molecular Formula | C16H19N3 |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.16 |
| IUPAC Name | 2-methyl-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)quinolin-4-amine |
| SMILES | Cc1cc(NCC2=CCNCC2)c2ccccc2n1 |
| InChI | InChI=1S/C16H19N3/c1-12-10-16(14-4-2-3-5-15(14)19-12)18-11-13-6-8-17-9-7-13/h2-6,10,17H,7-9,11H2,1H3,(H,18,19) |
| InChIKey | RSZOMQYFCLRMAH-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|