C14H13N3S — CID 61283485
2-methyl-N-(1,3-thiazol-2-ylmethyl)quinolin-4-amine (PubChem CID 61283485) has the molecular formula C14H13N3S and a molecular weight of 255.35 g/mol. Its IUPAC name is 2-methyl-N-(1,3-thiazol-2-ylmethyl)quinolin-4-amine.
| Compound Name | 2-methyl-N-(1,3-thiazol-2-ylmethyl)quinolin-4-amine |
|---|---|
| PubChem CID | 61283485 |
| Molecular Formula | C14H13N3S |
| Molecular Weight | 255.35 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | 2-methyl-N-(1,3-thiazol-2-ylmethyl)quinolin-4-amine |
| SMILES | Cc1cc(NCc2nccs2)c2ccccc2n1 |
| InChI | InChI=1S/C14H13N3S/c1-10-8-13(16-9-14-15-6-7-18-14)11-4-2-3-5-12(11)17-10/h2-8H,9H2,1H3,(H,16,17) |
| InChIKey | CEYUESVCTHXLSS-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.35 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |