C16H24N4O — CID 114694391
N,N-diethyl-4-(1,2,3,6-tetrahydropyridin-4-ylmethylamino)pyridine-2-carboxamide (PubChem CID 114694391) has the molecular formula C16H24N4O and a molecular weight of 288.39 g/mol. Its IUPAC name is N,N-diethyl-4-(1,2,3,6-tetrahydropyridin-4-ylmethylamino)pyridine-2-carboxamide.
| Compound Name | N,N-diethyl-4-(1,2,3,6-tetrahydropyridin-4-ylmethylamino)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 114694391 |
| Molecular Formula | C16H24N4O |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.20 |
| IUPAC Name | N,N-diethyl-4-(1,2,3,6-tetrahydropyridin-4-ylmethylamino)pyridine-2-carboxamide |
| SMILES | CCN(CC)C(=O)c1cc(NCC2=CCNCC2)ccn1 |
| InChI | InChI=1S/C16H24N4O/c1-3-20(4-2)16(21)15-11-14(7-10-18-15)19-12-13-5-8-17-9-6-13/h5,7,10-11,17H,3-4,6,8-9,12H2,1-2H3,(H,18,19) |
| InChIKey | VLJFRVHRQDNLQV-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|