C9H15IN4O2 — CID 136979111
4-[2-(2-hydroxypropylamino)ethylamino]-5-iodo-1H-pyrimidin-6-one (PubChem CID 136979111) has the molecular formula C9H15IN4O2 and a molecular weight of 338.15 g/mol. Its IUPAC name is 4-[2-(2-hydroxypropylamino)ethylamino]-5-iodo-1H-pyrimidin-6-one.
| Compound Name | 4-[2-(2-hydroxypropylamino)ethylamino]-5-iodo-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136979111 |
| Molecular Formula | C9H15IN4O2 |
| Molecular Weight | 338.15 g/mol |
| Exact Mass | 338.02 |
| IUPAC Name | 4-[2-(2-hydroxypropylamino)ethylamino]-5-iodo-1H-pyrimidin-6-one |
| SMILES | CC(O)CNCCNc1nc[nH]c(=O)c1I |
| InChI | InChI=1S/C9H15IN4O2/c1-6(15)4-11-2-3-12-8-7(10)9(16)14-5-13-8/h5-6,11,15H,2-4H2,1H3,(H2,12,13,14,16) |
| InChIKey | JPDWLTHLEKVSPI-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 90.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.15 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|