C7H10IN3O3 — CID 136956912
4-(2,3-dihydroxypropylamino)-5-iodo-1H-pyrimidin-6-one (PubChem CID 136956912) has the molecular formula C7H10IN3O3 and a molecular weight of 311.08 g/mol. Its IUPAC name is 4-(2,3-dihydroxypropylamino)-5-iodo-1H-pyrimidin-6-one.
| Compound Name | 4-(2,3-dihydroxypropylamino)-5-iodo-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136956912 |
| Molecular Formula | C7H10IN3O3 |
| Molecular Weight | 311.08 g/mol |
| Exact Mass | 310.98 |
| IUPAC Name | 4-(2,3-dihydroxypropylamino)-5-iodo-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]cnc(NCC(O)CO)c1I |
| InChI | InChI=1S/C7H10IN3O3/c8-5-6(9-1-4(13)2-12)10-3-11-7(5)14/h3-4,12-13H,1-2H2,(H2,9,10,11,14) |
| InChIKey | IQAOJHWKRMHHME-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 98.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.08 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|