C7H12N4O3 — CID 135451137
2-amino-4-(2,3-dihydroxypropylamino)-1H-pyrimidin-6-one (PubChem CID 135451137) has the molecular formula C7H12N4O3 and a molecular weight of 200.20 g/mol. Its IUPAC name is 2-amino-4-(2,3-dihydroxypropylamino)-1H-pyrimidin-6-one.
| Compound Name | 2-amino-4-(2,3-dihydroxypropylamino)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135451137 |
| Molecular Formula | C7H12N4O3 |
| Molecular Weight | 200.20 g/mol |
| Exact Mass | 200.09 |
| IUPAC Name | 2-amino-4-(2,3-dihydroxypropylamino)-1H-pyrimidin-6-one |
| SMILES | Nc1nc(NCC(O)CO)cc(=O)[nH]1 |
| InChI | InChI=1S/C7H12N4O3/c8-7-10-5(1-6(14)11-7)9-2-4(13)3-12/h1,4,12-13H,2-3H2,(H4,8,9,10,11,14) |
| InChIKey | DFBHHJIGZSYBAD-UHFFFAOYSA-N |
| XLogP | -1.88 |
| TPSA | 124.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.20 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |