C7H11N3O3 — CID 163296378
2-amino-1-(2,3-dihydroxypropyl)pyrimidin-4-one (PubChem CID 163296378) has the molecular formula C7H11N3O3 and a molecular weight of 185.18 g/mol. Its IUPAC name is 2-amino-1-(2,3-dihydroxypropyl)pyrimidin-4-one.
| Compound Name | 2-amino-1-(2,3-dihydroxypropyl)pyrimidin-4-one |
|---|---|
| PubChem CID | 163296378 |
| Molecular Formula | C7H11N3O3 |
| Molecular Weight | 185.18 g/mol |
| Exact Mass | 185.08 |
| IUPAC Name | 2-amino-1-(2,3-dihydroxypropyl)pyrimidin-4-one |
| SMILES | Nc1nc(=O)ccn1CC(O)CO |
| InChI | InChI=1S/C7H11N3O3/c8-7-9-6(13)1-2-10(7)3-5(12)4-11/h1-2,5,11-12H,3-4H2,(H2,8,9,13) |
| InChIKey | KAJYILDLOCPTGK-UHFFFAOYSA-N |
| XLogP | -1.82 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.18 |
| LogP ≤ 5 | -1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |