About 4-[1-(aminomethyl)-3,4-dihydro-1H-isoquinolin-2-yl]-5-methoxy-1H-pyrimidin-6-one
4-[1-(aminomethyl)-3,4-dihydro-1H-isoquinolin-2-yl]-5-methoxy-1H-pyrimidin-6-one (PubChem CID 136979469) has the molecular formula C15H18N4O2
and a molecular weight of 286.34 g/mol. Its IUPAC name is 4-[1-(aminomethyl)-3,4-dihydro-1H-isoquinolin-2-yl]-5-methoxy-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 4-[1-(aminomethyl)-3,4-dihydro-1H-isoquinolin-2-yl]-5-methoxy-1H-pyrimidin-6-one |
| PubChem CID | 136979469 |
| Molecular Formula | C15H18N4O2 |
| Molecular Weight | 286.34 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 4-[1-(aminomethyl)-3,4-dihydro-1H-isoquinolin-2-yl]-5-methoxy-1H-pyrimidin-6-one |
| SMILES | COc1c(N2CCc3ccccc3C2CN)nc[nH]c1=O |
| InChI | InChI=1S/C15H18N4O2/c1-21-13-14(17-9-18-15(13)20)19-7-6-10-4-2-3-5-11(10)12(19)8-16/h2-5,9,12H,6-8,16H2,1H3,(H,17,18,20) |
| InChIKey | QDPUSEFOZJAUQC-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.34 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[1-(aminomethyl)-3,4-dihydro-1H-isoquinolin-2-yl]-5-methoxy-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-(aminomethyl)-3,4-dihydro-1H-isoquinolin-2-yl]-5-methoxy-1H-pyrimidin-6-one?
The IUPAC name of 4-[1-(aminomethyl)-3,4-dihydro-1H-isoquinolin-2-yl]-5-methoxy-1H-pyrimidin-6-one (CID 136979469) is 4-[1-(aminomethyl)-3,4-dihydro-1H-isoquinolin-2-yl]-5-methoxy-1H-pyrimidin-6-one.
What is the SMILES notation for 4-[1-(aminomethyl)-3,4-dihydro-1H-isoquinolin-2-yl]-5-methoxy-1H-pyrimidin-6-one?
The canonical SMILES for 4-[1-(aminomethyl)-3,4-dihydro-1H-isoquinolin-2-yl]-5-methoxy-1H-pyrimidin-6-one is COc1c(N2CCc3ccccc3C2CN)nc[nH]c1=O.
What is the InChIKey of 4-[1-(aminomethyl)-3,4-dihydro-1H-isoquinolin-2-yl]-5-methoxy-1H-pyrimidin-6-one?
The InChIKey is QDPUSEFOZJAUQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N4O2/c1-21-13-14(17-9-18-15(13)20)19-7-6-10-4-2-3-5-11(10)12(19)8-16/h2-5,9,12H,6-8,16H2,1H3,(H,17,18,20).
What are the key properties of 4-[1-(aminomethyl)-3,4-dihydro-1H-isoquinolin-2-yl]-5-methoxy-1H-pyrimidin-6-one?
4-[1-(aminomethyl)-3,4-dihydro-1H-isoquinolin-2-yl]-5-methoxy-1H-pyrimidin-6-one has a molecular weight of 286.34 g/mol, XLogP of 0.84, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-(aminomethyl)-3,4-dihydro-1H-isoquinolin-2-yl]-5-methoxy-1H-pyrimidin-6-one is sourced from PubChem (CID 136979469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).