C17H17IN6O — CID 136980265
3-[1-[(5-iodofuran-2-yl)methyl]piperidin-4-yl]-4,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene (PubChem CID 136980265) has the molecular formula C17H17IN6O and a molecular weight of 448.27 g/mol. Its IUPAC name is 3-[1-[(5-iodofuran-2-yl)methyl]piperidin-4-yl]-4,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene.
| Compound Name | 3-[1-[(5-iodofuran-2-yl)methyl]piperidin-4-yl]-4,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
|---|---|
| PubChem CID | 136980265 |
| Molecular Formula | C17H17IN6O |
| Molecular Weight | 448.27 g/mol |
| Exact Mass | 448.05 |
| IUPAC Name | 3-[1-[(5-iodofuran-2-yl)methyl]piperidin-4-yl]-4,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
| SMILES | Ic1ccc(CN2CCC(c3nnn4cnc5[nH]ccc5c34)CC2)o1 |
| InChI | InChI=1S/C17H17IN6O/c18-14-2-1-12(25-14)9-23-7-4-11(5-8-23)15-16-13-3-6-19-17(13)20-10-24(16)22-21-15/h1-3,6,10-11,19H,4-5,7-9H2 |
| InChIKey | HGXYUBYGYVZMRL-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.27 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|