C19H16N4O4 — CID 136981378
methyl 11-[(3-methoxyphenyl)methyl]-13-oxo-3,8,10,12-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10-pentaene-5-carboxylate (PubChem CID 136981378) has the molecular formula C19H16N4O4 and a molecular weight of 364.36 g/mol. Its IUPAC name is methyl 11-[(3-methoxyphenyl)methyl]-13-oxo-3,8,10,12-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10-pentaene-5-carboxylate.
| Compound Name | methyl 11-[(3-methoxyphenyl)methyl]-13-oxo-3,8,10,12-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10-pentaene-5-carboxylate |
|---|---|
| PubChem CID | 136981378 |
| Molecular Formula | C19H16N4O4 |
| Molecular Weight | 364.36 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | methyl 11-[(3-methoxyphenyl)methyl]-13-oxo-3,8,10,12-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10-pentaene-5-carboxylate |
| SMILES | COC(=O)c1cnc2c(c1)[nH]c1nc(Cc3cccc(OC)c3)[nH]c(=O)c12 |
| InChI | InChI=1S/C19H16N4O4/c1-26-12-5-3-4-10(6-12)7-14-22-17-15(18(24)23-14)16-13(21-17)8-11(9-20-16)19(25)27-2/h3-6,8-9H,7H2,1-2H3,(H2,21,22,23,24) |
| InChIKey | WMQYYHGICVHFPH-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 109.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.36 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |