C15H10N4O3S — CID 146336794
13-oxo-11-(thiophen-3-ylmethyl)-3,8,10,12-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10-pentaene-5-carboxylic acid (PubChem CID 146336794) has the molecular formula C15H10N4O3S and a molecular weight of 326.34 g/mol. Its IUPAC name is 13-oxo-11-(thiophen-3-ylmethyl)-3,8,10,12-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10-pentaene-5-carboxylic acid.
| Compound Name | 13-oxo-11-(thiophen-3-ylmethyl)-3,8,10,12-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10-pentaene-5-carboxylic acid |
|---|---|
| PubChem CID | 146336794 |
| Molecular Formula | C15H10N4O3S |
| Molecular Weight | 326.34 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | 13-oxo-11-(thiophen-3-ylmethyl)-3,8,10,12-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10-pentaene-5-carboxylic acid |
| SMILES | O=C(O)c1cnc2c(c1)[nH]c1nc(Cc3ccsc3)[nH]c(=O)c12 |
| InChI | InChI=1S/C15H10N4O3S/c20-14-11-12-9(4-8(5-16-12)15(21)22)17-13(11)18-10(19-14)3-7-1-2-23-6-7/h1-2,4-6H,3H2,(H,21,22)(H2,17,18,19,20) |
| InChIKey | CRRQWWKKKCJLRL-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 111.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.34 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |