C18H12ClFN4O2 — CID 118471299
methyl 13-chloro-11-[(3-fluorophenyl)methyl]-3,8,10,12-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-5-carboxylate (PubChem CID 118471299) has the molecular formula C18H12ClFN4O2 and a molecular weight of 370.77 g/mol. Its IUPAC name is methyl 13-chloro-11-[(3-fluorophenyl)methyl]-3,8,10,12-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-5-carboxylate.
| Compound Name | methyl 13-chloro-11-[(3-fluorophenyl)methyl]-3,8,10,12-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-5-carboxylate |
|---|---|
| PubChem CID | 118471299 |
| Molecular Formula | C18H12ClFN4O2 |
| Molecular Weight | 370.77 g/mol |
| Exact Mass | 370.06 |
| IUPAC Name | methyl 13-chloro-11-[(3-fluorophenyl)methyl]-3,8,10,12-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-5-carboxylate |
| SMILES | COC(=O)c1cnc2c(c1)[nH]c1nc(Cc3cccc(F)c3)nc(Cl)c12 |
| InChI | InChI=1S/C18H12ClFN4O2/c1-26-18(25)10-7-12-15(21-8-10)14-16(19)23-13(24-17(14)22-12)6-9-3-2-4-11(20)5-9/h2-5,7-8H,6H2,1H3,(H,22,23,24) |
| InChIKey | IFBUFRSBYZWDCU-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.77 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |